C16H19FN2O4 — CID 16919419
ethyl 2-[[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]methylamino]-2-oxoacetate (PubChem CID 16919419) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is ethyl 2-[[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]methylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 16919419 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | ethyl 2-[[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]methylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC1CC(=O)N(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H19FN2O4/c1-2-23-16(22)15(21)18-8-12-7-14(20)19(10-12)9-11-3-5-13(17)6-4-11/h3-6,12H,2,7-10H2,1H3,(H,18,21) |
| InChIKey | TUYFTGQNSJINFP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|