C15H16ClN3O2 — CID 169194624
8-chloro-3-ethoxy-1,3,5-trimethylpyrrolo[3,2-g]phthalazin-2-one (PubChem CID 169194624) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 8-chloro-3-ethoxy-1,3,5-trimethylpyrrolo[3,2-g]phthalazin-2-one.
| Compound Name | 8-chloro-3-ethoxy-1,3,5-trimethylpyrrolo[3,2-g]phthalazin-2-one |
|---|---|
| PubChem CID | 169194624 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 8-chloro-3-ethoxy-1,3,5-trimethylpyrrolo[3,2-g]phthalazin-2-one |
| SMILES | CCOC1(C)C(=O)N(C)c2cc3c(Cl)nnc(C)c3cc21 |
| InChI | InChI=1S/C15H16ClN3O2/c1-5-21-15(3)11-6-9-8(2)17-18-13(16)10(9)7-12(11)19(4)14(15)20/h6-7H,5H2,1-4H3 |
| InChIKey | PMCJVSXNDDLHHW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |