C23H24ClN5O4 — CID 169195094
N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-[(2S)-2-formylmorpholin-4-yl]pyridazine-3-carboxamide (PubChem CID 169195094) has the molecular formula C23H24ClN5O4 and a molecular weight of 469.93 g/mol. Its IUPAC name is N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-[(2S)-2-formylmorpholin-4-yl]pyridazine-3-carboxamide.
| Compound Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-[(2S)-2-formylmorpholin-4-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169195094 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-[(2S)-2-formylmorpholin-4-yl]pyridazine-3-carboxamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)c3ccc(N4CCO[C@H](C=O)C4)nn3)CC2)cc1Cl |
| InChI | InChI=1S/C23H24ClN5O4/c24-20-11-18(4-1-15(20)12-25)33-17-5-2-16(3-6-17)26-23(31)21-7-8-22(28-27-21)29-9-10-32-19(13-29)14-30/h1,4,7-8,11,14,16-17,19H,2-3,5-6,9-10,13H2,(H,26,31)/t16?,17?,19-/m0/s1 |
| InChIKey | IRFBGJJCKOZNMO-TVPLGVNVSA-N |
| XLogP | 2.53 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|