C13H19NO — CID 169195661
(5E)-5-[(E)-1-aminoprop-1-enyl]-2-methyl-3-methylideneocta-5,7-dien-4-one (PubChem CID 169195661) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (5E)-5-[(E)-1-aminoprop-1-enyl]-2-methyl-3-methylideneocta-5,7-dien-4-one.
| Compound Name | (5E)-5-[(E)-1-aminoprop-1-enyl]-2-methyl-3-methylideneocta-5,7-dien-4-one |
|---|---|
| PubChem CID | 169195661 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (5E)-5-[(E)-1-aminoprop-1-enyl]-2-methyl-3-methylideneocta-5,7-dien-4-one |
| SMILES | C=C/C=C(C(=O)C(=C)C(C)C)\C(N)=C/C |
| InChI | InChI=1S/C13H19NO/c1-6-8-11(12(14)7-2)13(15)10(5)9(3)4/h6-9H,1,5,14H2,2-4H3/b11-8+,12-7+ |
| InChIKey | QPLJVFHMFZOTJM-NFLJZBCPSA-N |
| XLogP | 2.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|