About ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione
ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione (PubChem CID 169195750) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione |
| PubChem CID | 169195750 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione |
| SMILES | CC.CCC(C)(C)OCCC(C)(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H23NO3.C2H6/c1-6-14(4,5)18-10-9-13(2,3)15-11(16)7-8-12(15)17;1-2/h7-8H,6,9-10H2,1-5H3;1-2H3 |
| InChIKey | RXFZOCXRHUCNQZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione?
The IUPAC name of ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione (CID 169195750) is ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione.
What is the SMILES notation for ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione?
The canonical SMILES for ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione is CC.CCC(C)(C)OCCC(C)(C)N1C(=O)C=CC1=O.
What is the InChIKey of ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione?
The InChIKey is RXFZOCXRHUCNQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3.C2H6/c1-6-14(4,5)18-10-9-13(2,3)15-11(16)7-8-12(15)17;1-2/h7-8H,6,9-10H2,1-5H3;1-2H3.
What are the key properties of ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione?
ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione has a molecular weight of 283.41 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]pyrrole-2,5-dione is sourced from PubChem (CID 169195750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).