C19H19ClN4O3S — CID 169196590
tert-butyl N-[5-[(2-chloro-4-pyridinyl)oxy]-4-(6-methyl-2-pyridinyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 169196590) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-chloro-4-pyridinyl)oxy]-4-(6-methyl-2-pyridinyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-chloro-4-pyridinyl)oxy]-4-(6-methyl-2-pyridinyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 169196590 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | tert-butyl N-[5-[(2-chloro-4-pyridinyl)oxy]-4-(6-methyl-2-pyridinyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | Cc1cccc(-c2nc(NC(=O)OC(C)(C)C)sc2Oc2ccnc(Cl)c2)n1 |
| InChI | InChI=1S/C19H19ClN4O3S/c1-11-6-5-7-13(22-11)15-16(26-12-8-9-21-14(20)10-12)28-17(23-15)24-18(25)27-19(2,3)4/h5-10H,1-4H3,(H,23,24,25) |
| InChIKey | BWHUBEMMFSIWQT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|