C17H16FN3O5S — CID 16919680
N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-4-nitrobenzenesulfonamide (PubChem CID 16919680) has the molecular formula C17H16FN3O5S and a molecular weight of 393.40 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16919680 |
| Molecular Formula | C17H16FN3O5S |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-4-nitrobenzenesulfonamide |
| SMILES | O=C1CC(CNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CN1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3O5S/c18-13-1-3-14(4-2-13)20-11-12(9-17(20)22)10-19-27(25,26)16-7-5-15(6-8-16)21(23)24/h1-8,12,19H,9-11H2 |
| InChIKey | HQZMNFHCYLWLHR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|