C17H15Cl2N5O — CID 169197058
3-(6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,2-dihydroimidazole-5-carbonitrile (PubChem CID 169197058) has the molecular formula C17H15Cl2N5O and a molecular weight of 376.25 g/mol. Its IUPAC name is 3-(6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,2-dihydroimidazole-5-carbonitrile.
| Compound Name | 3-(6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,2-dihydroimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 169197058 |
| Molecular Formula | C17H15Cl2N5O |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 3-(6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,2-dihydroimidazole-5-carbonitrile |
| SMILES | CC1c2c([nH]c3c(Cl)c(Cl)ccc23)CCN1C(=O)N1C=C(C#N)NC1 |
| InChI | InChI=1S/C17H15Cl2N5O/c1-9-14-11-2-3-12(18)15(19)16(11)22-13(14)4-5-24(9)17(25)23-7-10(6-20)21-8-23/h2-3,7,9,21-22H,4-5,8H2,1H3 |
| InChIKey | AZJCTKIXJSXTHM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|