C11H9BrCl2N2 — CID 169197084
9-bromo-6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 169197084) has the molecular formula C11H9BrCl2N2 and a molecular weight of 320.02 g/mol. Its IUPAC name is 9-bromo-6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 9-bromo-6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 169197084 |
| Molecular Formula | C11H9BrCl2N2 |
| Molecular Weight | 320.02 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 9-bromo-6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Clc1cc(Br)c2c3c([nH]c2c1Cl)CCNC3 |
| InChI | InChI=1S/C11H9BrCl2N2/c12-6-3-7(13)10(14)11-9(6)5-4-15-2-1-8(5)16-11/h3,15-16H,1-2,4H2 |
| InChIKey | FNVSOXQEMOHKEX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.02 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|