C14H15Cl2N3O — CID 169197127
2-amino-1-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone (PubChem CID 169197127) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 2-amino-1-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone.
| Compound Name | 2-amino-1-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 169197127 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-amino-1-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone |
| SMILES | C[C@@H]1c2c([nH]c3c(Cl)c(Cl)ccc23)CCN1C(=O)CN |
| InChI | InChI=1S/C14H15Cl2N3O/c1-7-12-8-2-3-9(15)13(16)14(8)18-10(12)4-5-19(7)11(20)6-17/h2-3,7,18H,4-6,17H2,1H3/t7-/m1/s1 |
| InChIKey | KBPBOMQDALNHMG-SSDOTTSWSA-N |
| XLogP | 2.88 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|