C12H11BrCl2N2 — CID 169197165
9-bromo-6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 169197165) has the molecular formula C12H11BrCl2N2 and a molecular weight of 334.04 g/mol. Its IUPAC name is 9-bromo-6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 9-bromo-6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 169197165 |
| Molecular Formula | C12H11BrCl2N2 |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 9-bromo-6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | CC1NCCc2[nH]c3c(Cl)c(Cl)cc(Br)c3c21 |
| InChI | InChI=1S/C12H11BrCl2N2/c1-5-9-8(2-3-16-5)17-12-10(9)6(13)4-7(14)11(12)15/h4-5,16-17H,2-3H2,1H3 |
| InChIKey | YGEAUKKDMBZOJV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|