C23H20Cl2N6O2 — CID 169197223
[(1S)-9-(6-amino-3-pyridinyl)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone (PubChem CID 169197223) has the molecular formula C23H20Cl2N6O2 and a molecular weight of 483.36 g/mol. Its IUPAC name is [(1S)-9-(6-amino-3-pyridinyl)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone.
| Compound Name | [(1S)-9-(6-amino-3-pyridinyl)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 169197223 |
| Molecular Formula | C23H20Cl2N6O2 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [(1S)-9-(6-amino-3-pyridinyl)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone |
| SMILES | COc1cnc(C(=O)N2CCc3[nH]c4c(Cl)c(Cl)cc(-c5ccc(N)nc5)c4c3[C@@H]2C)nc1 |
| InChI | InChI=1S/C23H20Cl2N6O2/c1-11-18-16(5-6-31(11)23(32)22-28-9-13(33-2)10-29-22)30-21-19(18)14(7-15(24)20(21)25)12-3-4-17(26)27-8-12/h3-4,7-11,30H,5-6H2,1-2H3,(H2,26,27)/t11-/m0/s1 |
| InChIKey | BSZQLXVTJABIGW-NSHDSACASA-N |
| XLogP | 4.68 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |