C17H14Cl2N4O2 — CID 169197379
[(1R)-5,6-dichloro-1-methyl-3,4-dihydro-1H-pyrrolo[3,4-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone (PubChem CID 169197379) has the molecular formula C17H14Cl2N4O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is [(1R)-5,6-dichloro-1-methyl-3,4-dihydro-1H-pyrrolo[3,4-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone.
| Compound Name | [(1R)-5,6-dichloro-1-methyl-3,4-dihydro-1H-pyrrolo[3,4-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 169197379 |
| Molecular Formula | C17H14Cl2N4O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [(1R)-5,6-dichloro-1-methyl-3,4-dihydro-1H-pyrrolo[3,4-b]indol-2-yl]-(5-methoxypyrimidin-2-yl)methanone |
| SMILES | COc1cnc(C(=O)N2Cc3[nH]c4c(Cl)c(Cl)ccc4c3[C@H]2C)nc1 |
| InChI | InChI=1S/C17H14Cl2N4O2/c1-8-13-10-3-4-11(18)14(19)15(10)22-12(13)7-23(8)17(24)16-20-5-9(25-2)6-21-16/h3-6,8,22H,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | KDPUTMGYOKUREG-MRVPVSSYSA-N |
| XLogP | 3.99 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|