C29H28F2N4O2S — CID 169198059
N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(9,9-difluorofluoren-3-yl)acetyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 169198059) has the molecular formula C29H28F2N4O2S and a molecular weight of 534.63 g/mol. Its IUPAC name is N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(9,9-difluorofluoren-3-yl)acetyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(9,9-difluorofluoren-3-yl)acetyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 169198059 |
| Molecular Formula | C29H28F2N4O2S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(9,9-difluorofluoren-3-yl)acetyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC3C(C)C3N2C(=O)Cc2ccc3c(c2)-c2ccccc2C3(F)F)c1 |
| InChI | InChI=1S/C29H28F2N4O2S/c1-14-19-12-23(28(37)34-15(2)24-11-17(13-38-24)27(32)33)35(26(14)19)25(36)10-16-7-8-22-20(9-16)18-5-3-4-6-21(18)29(22,30)31/h3-9,11,13-15,19,23,26H,10,12H2,1-2H3,(H3,32,33)(H,34,37)/t14?,15-,19?,23?,26?/m1/s1 |
| InChIKey | WTCMHBAIOCXAKQ-WSOXYVQQSA-N |
| XLogP | 4.81 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|