About methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate
methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate (PubChem CID 169198111) has the molecular formula C18H16O2S2
and a molecular weight of 328.46 g/mol. Its IUPAC name is methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate.
Molecular Properties
| Compound Name | methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate |
| PubChem CID | 169198111 |
| Molecular Formula | C18H16O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate |
| SMILES | COC(=O)c1cc(C)c2c(c1)-c1ccccc1C21SCCS1 |
| InChI | InChI=1S/C18H16O2S2/c1-11-9-12(17(19)20-2)10-14-13-5-3-4-6-15(13)18(16(11)14)21-7-8-22-18/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | SIOHFZDMSARWPZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate?
The IUPAC name of methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate (CID 169198111) is methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate.
What is the SMILES notation for methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate?
The canonical SMILES for methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate is COC(=O)c1cc(C)c2c(c1)-c1ccccc1C21SCCS1.
What is the InChIKey of methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate?
The InChIKey is SIOHFZDMSARWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O2S2/c1-11-9-12(17(19)20-2)10-14-13-5-3-4-6-15(13)18(16(11)14)21-7-8-22-18/h3-6,9-10H,7-8H2,1-2H3.
What are the key properties of methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate?
methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate has a molecular weight of 328.46 g/mol, XLogP of 4.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1'-methylspiro[1,3-dithiolane-2,9'-fluorene]-3'-carboxylate is sourced from PubChem (CID 169198111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).