C27H27FN6O5S — CID 169198426
(8S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[[4-(6-fluoro-3-pyridinyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 169198426) has the molecular formula C27H27FN6O5S and a molecular weight of 566.62 g/mol. Its IUPAC name is (8S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[[4-(6-fluoro-3-pyridinyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | (8S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[[4-(6-fluoro-3-pyridinyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 169198426 |
| Molecular Formula | C27H27FN6O5S |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | (8S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[[4-(6-fluoro-3-pyridinyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2CC3(CN2C(=O)CNC(=O)c2ccc(-c4ccc(F)nc4)cc2)OCCO3)c1 |
| InChI | InChI=1S/C27H27FN6O5S/c28-22-6-5-18(11-31-22)16-1-3-17(4-2-16)25(36)33-13-23(35)34-15-27(38-7-8-39-27)10-21(34)26(37)32-12-20-9-19(14-40-20)24(29)30/h1-6,9,11,14,21H,7-8,10,12-13,15H2,(H3,29,30)(H,32,37)(H,33,36)/t21-/m0/s1 |
| InChIKey | ALYBZWPPTRJOQP-NRFANRHFSA-N |
| XLogP | 1.62 |
| TPSA | 159.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|