About 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane
8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane (PubChem CID 169199637) has the molecular formula C18H19F2NO2
and a molecular weight of 319.35 g/mol. Its IUPAC name is 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane |
| PubChem CID | 169199637 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1cnc2c(C3=CCC(F)(F)CC3)cccc2c1 |
| InChI | InChI=1S/C16H13F2NO2.C2H6/c17-16(18)6-4-10(5-7-16)13-3-1-2-11-8-12(15(20)21)9-19-14(11)13;1-2/h1-4,8-9H,5-7H2,(H,20,21);1-2H3 |
| InChIKey | CNIQOVXFLBGWSU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane?
The IUPAC name of 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane (CID 169199637) is 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane.
What is the SMILES notation for 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane?
The canonical SMILES for 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane is CC.O=C(O)c1cnc2c(C3=CCC(F)(F)CC3)cccc2c1.
What is the InChIKey of 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane?
The InChIKey is CNIQOVXFLBGWSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO2.C2H6/c17-16(18)6-4-10(5-7-16)13-3-1-2-11-8-12(15(20)21)9-19-14(11)13;1-2/h1-4,8-9H,5-7H2,(H,20,21);1-2H3.
What are the key properties of 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane?
8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane has a molecular weight of 319.35 g/mol, XLogP of 5.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4,4-difluorocyclohexen-1-yl)quinoline-3-carboxylic acid;ethane is sourced from PubChem (CID 169199637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).