About cyclohexen-1-amine;2,3-dimethylbutan-2-ol
cyclohexen-1-amine;2,3-dimethylbutan-2-ol (PubChem CID 169199701) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is cyclohexen-1-amine;2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | cyclohexen-1-amine;2,3-dimethylbutan-2-ol |
| PubChem CID | 169199701 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | cyclohexen-1-amine;2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(C)O.NC1=CCCCC1 |
| InChI | InChI=1S/C6H11N.C6H14O/c7-6-4-2-1-3-5-6;1-5(2)6(3,4)7/h4H,1-3,5,7H2;5,7H,1-4H3 |
| InChIKey | JIMWZKLMILMVTA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexen-1-amine;2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-amine;2,3-dimethylbutan-2-ol?
The IUPAC name of cyclohexen-1-amine;2,3-dimethylbutan-2-ol (CID 169199701) is cyclohexen-1-amine;2,3-dimethylbutan-2-ol.
What is the SMILES notation for cyclohexen-1-amine;2,3-dimethylbutan-2-ol?
The canonical SMILES for cyclohexen-1-amine;2,3-dimethylbutan-2-ol is CC(C)C(C)(C)O.NC1=CCCCC1.
What is the InChIKey of cyclohexen-1-amine;2,3-dimethylbutan-2-ol?
The InChIKey is JIMWZKLMILMVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C6H14O/c7-6-4-2-1-3-5-6;1-5(2)6(3,4)7/h4H,1-3,5,7H2;5,7H,1-4H3.
What are the key properties of cyclohexen-1-amine;2,3-dimethylbutan-2-ol?
cyclohexen-1-amine;2,3-dimethylbutan-2-ol has a molecular weight of 199.34 g/mol, XLogP of 2.82, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-amine;2,3-dimethylbutan-2-ol is sourced from PubChem (CID 169199701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).