About 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine
2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine (PubChem CID 169199888) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine.
Molecular Properties
| Compound Name | 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine |
| PubChem CID | 169199888 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine |
| SMILES | CC(C)C(C)(C)O.NC1=CCC2(CC1)CC2 |
| InChI | InChI=1S/C8H13N.C6H14O/c9-7-1-3-8(4-2-7)5-6-8;1-5(2)6(3,4)7/h1H,2-6,9H2;5,7H,1-4H3 |
| InChIKey | GEWYHOLTNOUBCN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine?
The IUPAC name of 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine (CID 169199888) is 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine.
What is the SMILES notation for 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine?
The canonical SMILES for 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine is CC(C)C(C)(C)O.NC1=CCC2(CC1)CC2.
What is the InChIKey of 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine?
The InChIKey is GEWYHOLTNOUBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.C6H14O/c9-7-1-3-8(4-2-7)5-6-8;1-5(2)6(3,4)7/h1H,2-6,9H2;5,7H,1-4H3.
What are the key properties of 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine?
2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine has a molecular weight of 225.38 g/mol, XLogP of 3.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutan-2-ol;spiro[2.5]oct-6-en-6-amine is sourced from PubChem (CID 169199888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).