About 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine
2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine (PubChem CID 169200569) has the molecular formula C19H42N2O2
and a molecular weight of 330.56 g/mol. Its IUPAC name is 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine |
| PubChem CID | 169200569 |
| Molecular Formula | C19H42N2O2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.32 |
| IUPAC Name | 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine |
| SMILES | CC.CC(C)N1CCO[C@H](C)C1.CC1CN(C(C)C)CC(C)O1 |
| InChI | InChI=1S/C9H19NO.C8H17NO.C2H6/c1-7(2)10-5-8(3)11-9(4)6-10;1-7(2)9-4-5-10-8(3)6-9;1-2/h7-9H,5-6H2,1-4H3;7-8H,4-6H2,1-3H3;1-2H3/t;8-;/m.1./s1 |
| InChIKey | GNYULDPNCRKDGO-RORZRARGSA-N |
| XLogP | 3.65 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine?
The IUPAC name of 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine (CID 169200569) is 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine.
What is the SMILES notation for 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine?
The canonical SMILES for 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine is CC.CC(C)N1CCO[C@H](C)C1.CC1CN(C(C)C)CC(C)O1.
What is the InChIKey of 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine?
The InChIKey is GNYULDPNCRKDGO-RORZRARGSA-N. The full InChI is InChI=1S/C9H19NO.C8H17NO.C2H6/c1-7(2)10-5-8(3)11-9(4)6-10;1-7(2)9-4-5-10-8(3)6-9;1-2/h7-9H,5-6H2,1-4H3;7-8H,4-6H2,1-3H3;1-2H3/t;8-;/m.1./s1.
What are the key properties of 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine?
2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine has a molecular weight of 330.56 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-propan-2-ylmorpholine;ethane;(2R)-2-methyl-4-propan-2-ylmorpholine is sourced from PubChem (CID 169200569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).