C22H23F2N5O2 — CID 169200639
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[2-fluoro-5-(2-fluoro-4-methoxyphenyl)-3-pyridinyl]pyrimidin-4-amine (PubChem CID 169200639) has the molecular formula C22H23F2N5O2 and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[2-fluoro-5-(2-fluoro-4-methoxyphenyl)-3-pyridinyl]pyrimidin-4-amine.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[2-fluoro-5-(2-fluoro-4-methoxyphenyl)-3-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 169200639 |
| Molecular Formula | C22H23F2N5O2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[2-fluoro-5-(2-fluoro-4-methoxyphenyl)-3-pyridinyl]pyrimidin-4-amine |
| SMILES | COc1ccc(-c2cnc(F)c(Nc3ccnc(N4C[C@@H](C)O[C@@H](C)C4)n3)c2)c(F)c1 |
| InChI | InChI=1S/C22H23F2N5O2/c1-13-11-29(12-14(2)31-13)22-25-7-6-20(28-22)27-19-8-15(10-26-21(19)24)17-5-4-16(30-3)9-18(17)23/h4-10,13-14H,11-12H2,1-3H3,(H,25,27,28)/t13-,14+ |
| InChIKey | LBXOLUWKLKWZGB-OKILXGFUSA-N |
| XLogP | 4.18 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|