C21H27FN6O2 — CID 169200791
(Z)-N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-3-(2-fluoro-4-methoxyphenyl)-4-iminobut-2-enimidamide;molecular hydrogen (PubChem CID 169200791) has the molecular formula C21H27FN6O2 and a molecular weight of 414.49 g/mol. Its IUPAC name is (Z)-N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-3-(2-fluoro-4-methoxyphenyl)-4-iminobut-2-enimidamide;molecular hydrogen.
| Compound Name | (Z)-N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-3-(2-fluoro-4-methoxyphenyl)-4-iminobut-2-enimidamide;molecular hydrogen |
|---|---|
| PubChem CID | 169200791 |
| Molecular Formula | C21H27FN6O2 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (Z)-N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-3-(2-fluoro-4-methoxyphenyl)-4-iminobut-2-enimidamide;molecular hydrogen |
| SMILES | [H]/N=C/C(=C\C(N)=N\c1ccnc(N2C[C@@H](C)O[C@@H](C)C2)n1)c1ccc(OC)cc1F.[H][H] |
| InChI | InChI=1S/C21H25FN6O2.H2/c1-13-11-28(12-14(2)30-13)21-25-7-6-20(27-21)26-19(24)8-15(10-23)17-5-4-16(29-3)9-18(17)22;/h4-10,13-14,23H,11-12H2,1-3H3,(H2,24,25,26,27);1H/b15-8+,23-10+;/t13-,14+; |
| InChIKey | HZCLJIOFPIVHJL-HXRAMHKCSA-N |
| XLogP | 3.21 |
| TPSA | 109.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|