C10H13F2N3O — CID 169200973
(2S,6R)-4-(4,6-difluoropyrimidin-2-yl)-2,6-dimethylmorpholine (PubChem CID 169200973) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is (2S,6R)-4-(4,6-difluoropyrimidin-2-yl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(4,6-difluoropyrimidin-2-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 169200973 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (2S,6R)-4-(4,6-difluoropyrimidin-2-yl)-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2nc(F)cc(F)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C10H13F2N3O/c1-6-4-15(5-7(2)16-6)10-13-8(11)3-9(12)14-10/h3,6-7H,4-5H2,1-2H3/t6-,7+ |
| InChIKey | QTIARLGFVZPQPG-KNVOCYPGSA-N |
| XLogP | 1.37 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |