About 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile
3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile (PubChem CID 169202707) has the molecular formula C19H14BClN4O
and a molecular weight of 360.61 g/mol. Its IUPAC name is 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile |
| PubChem CID | 169202707 |
| Molecular Formula | C19H14BClN4O |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile |
| SMILES | N#CB1CCc2[nH]c(-c3ccncc3)c(Nc3ccccc3Cl)c2C1=O |
| InChI | InChI=1S/C19H14BClN4O/c21-13-3-1-2-4-14(13)24-18-16-15(5-8-20(11-22)19(16)26)25-17(18)12-6-9-23-10-7-12/h1-4,6-7,9-10,24-25H,5,8H2 |
| InChIKey | KSJNXEPTPZWEEI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile?
The IUPAC name of 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile (CID 169202707) is 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile.
What is the SMILES notation for 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile?
The canonical SMILES for 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile is N#CB1CCc2[nH]c(-c3ccncc3)c(Nc3ccccc3Cl)c2C1=O.
What is the InChIKey of 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile?
The InChIKey is KSJNXEPTPZWEEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14BClN4O/c21-13-3-1-2-4-14(13)24-18-16-15(5-8-20(11-22)19(16)26)25-17(18)12-6-9-23-10-7-12/h1-4,6-7,9-10,24-25H,5,8H2.
What are the key properties of 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile?
3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile has a molecular weight of 360.61 g/mol, XLogP of 4.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloroanilino)-4-oxo-2-pyridin-4-yl-6,7-dihydro-1H-borinino[4,3-b]pyrrole-5-carbonitrile is sourced from PubChem (CID 169202707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).