C15H14BNO3 — CID 169202834
6-oxospiro[1,8-dihydrofuro[3,4-e][2]benzofuran-3,4'-borinane]-1'-carbonitrile (PubChem CID 169202834) has the molecular formula C15H14BNO3 and a molecular weight of 267.09 g/mol. Its IUPAC name is 6-oxospiro[1,8-dihydrofuro[3,4-e][2]benzofuran-3,4'-borinane]-1'-carbonitrile.
| Compound Name | 6-oxospiro[1,8-dihydrofuro[3,4-e][2]benzofuran-3,4'-borinane]-1'-carbonitrile |
|---|---|
| PubChem CID | 169202834 |
| Molecular Formula | C15H14BNO3 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 6-oxospiro[1,8-dihydrofuro[3,4-e][2]benzofuran-3,4'-borinane]-1'-carbonitrile |
| SMILES | N#CB1CCC2(CC1)OCc1c2ccc2c1COC2=O |
| InChI | InChI=1S/C15H14BNO3/c17-9-16-5-3-15(4-6-16)13-2-1-10-11(7-19-14(10)18)12(13)8-20-15/h1-2H,3-8H2 |
| InChIKey | NWJIWJLYQRWJJU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|