C15H21FN2 — CID 169202930
N-ethyl-1-(6-fluoroindolizin-1-yl)-N-methylbutan-2-amine (PubChem CID 169202930) has the molecular formula C15H21FN2 and a molecular weight of 248.35 g/mol. Its IUPAC name is N-ethyl-1-(6-fluoroindolizin-1-yl)-N-methylbutan-2-amine.
| Compound Name | N-ethyl-1-(6-fluoroindolizin-1-yl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 169202930 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N-ethyl-1-(6-fluoroindolizin-1-yl)-N-methylbutan-2-amine |
| SMILES | CCC(Cc1ccn2cc(F)ccc12)N(C)CC |
| InChI | InChI=1S/C15H21FN2/c1-4-14(17(3)5-2)10-12-8-9-18-11-13(16)6-7-15(12)18/h6-9,11,14H,4-5,10H2,1-3H3 |
| InChIKey | DJPKNCZGAPRIIZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 7.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |