C20H27N3 — CID 169204088
(2R,6R)-4-ethyl-2,6-bis(3-methyl-2-pyridinyl)azepane (PubChem CID 169204088) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is (2R,6R)-4-ethyl-2,6-bis(3-methyl-2-pyridinyl)azepane.
| Compound Name | (2R,6R)-4-ethyl-2,6-bis(3-methyl-2-pyridinyl)azepane |
|---|---|
| PubChem CID | 169204088 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | (2R,6R)-4-ethyl-2,6-bis(3-methyl-2-pyridinyl)azepane |
| SMILES | CCC1C[C@@H](c2ncccc2C)CN[C@@H](c2ncccc2C)C1 |
| InChI | InChI=1S/C20H27N3/c1-4-16-11-17(19-14(2)7-5-9-21-19)13-23-18(12-16)20-15(3)8-6-10-22-20/h5-10,16-18,23H,4,11-13H2,1-3H3/t16?,17-,18-/m1/s1 |
| InChIKey | LBIIBKTWPNMOPN-UKKPGEIXSA-N |
| XLogP | 4.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |