C26H27ClF3N5O2S — CID 169204309
1-[(2S,6R)-4-[(12R)-8-chloro-2-hydroxy-12-pyridin-2-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 169204309) has the molecular formula C26H27ClF3N5O2S and a molecular weight of 566.05 g/mol. Its IUPAC name is 1-[(2S,6R)-4-[(12R)-8-chloro-2-hydroxy-12-pyridin-2-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,6R)-4-[(12R)-8-chloro-2-hydroxy-12-pyridin-2-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169204309 |
| Molecular Formula | C26H27ClF3N5O2S |
| Molecular Weight | 566.05 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 1-[(2S,6R)-4-[(12R)-8-chloro-2-hydroxy-12-pyridin-2-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1[C@H](C)CN(C2=NC(O)N3C[C@H](c4ccccn4)CSc4c(Cl)c(C(F)(F)F)cc2c43)C[C@@H]1C |
| InChI | InChI=1S/C26H27ClF3N5O2S/c1-4-20(36)35-14(2)10-33(11-15(35)3)24-17-9-18(26(28,29)30)21(27)23-22(17)34(25(37)32-24)12-16(13-38-23)19-7-5-6-8-31-19/h4-9,14-16,25,37H,1,10-13H2,2-3H3/t14-,15+,16-,25?/m0/s1 |
| InChIKey | HVSMQTNCBQOFKJ-NJVYVWJFSA-N |
| XLogP | 4.59 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.05 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|