C8H25NO4Si4 — CID 169204816
N,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine (PubChem CID 169204816) has the molecular formula C8H25NO4Si4 and a molecular weight of 311.64 g/mol. Its IUPAC name is N,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine.
| Compound Name | N,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
|---|---|
| PubChem CID | 169204816 |
| Molecular Formula | C8H25NO4Si4 |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
| SMILES | CN[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C8H25NO4Si4/c1-9-17(8)12-15(4,5)10-14(2,3)11-16(6,7)13-17/h9H,1-8H3 |
| InChIKey | SFRGALYWNAEJHY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|