About 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate
2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate (PubChem CID 169205253) has the molecular formula C17H22F3N3O
and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate.
Molecular Properties
| Compound Name | 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate |
| PubChem CID | 169205253 |
| Molecular Formula | C17H22F3N3O |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate |
| SMILES | C/C=C\N=C(OCCN)\C(=C\CC)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3N3O/c1-3-5-15(16(22-11-4-2)24-12-10-21)23-14-8-6-13(7-9-14)17(18,19)20/h4-9,11,23H,3,10,12,21H2,1-2H3/b11-4-,15-5-,22-16- |
| InChIKey | MOEHEMJQTALIQT-YOVMQMRCSA-N |
| XLogP | 4.32 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
The IUPAC name of 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate (CID 169205253) is 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate.
What is the SMILES notation for 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
The canonical SMILES for 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate is C/C=C\N=C(OCCN)\C(=C\CC)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
The InChIKey is MOEHEMJQTALIQT-YOVMQMRCSA-N. The full InChI is InChI=1S/C17H22F3N3O/c1-3-5-15(16(22-11-4-2)24-12-10-21)23-14-8-6-13(7-9-14)17(18,19)20/h4-9,11,23H,3,10,12,21H2,1-2H3/b11-4-,15-5-,22-16-.
What are the key properties of 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate has a molecular weight of 341.38 g/mol, XLogP of 4.32, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate is sourced from PubChem (CID 169205253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).