C24H31F2N3O3 — CID 169205323
2-[[4-[C-[(Z)-1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]but-1-enyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperidin-1-yl]methyl]prop-2-enoic acid (PubChem CID 169205323) has the molecular formula C24H31F2N3O3 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[[4-[C-[(Z)-1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]but-1-enyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperidin-1-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[4-[C-[(Z)-1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]but-1-enyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperidin-1-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 169205323 |
| Molecular Formula | C24H31F2N3O3 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[[4-[C-[(Z)-1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]but-1-enyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperidin-1-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(CN1CCC(C(=N/C=C\C)/C(=C/CC)Oc2ccc(C(C)(F)F)nc2)CC1)C(=O)O |
| InChI | InChI=1S/C24H31F2N3O3/c1-5-7-20(32-19-8-9-21(28-15-19)24(4,25)26)22(27-12-6-2)18-10-13-29(14-11-18)16-17(3)23(30)31/h6-9,12,15,18H,3,5,10-11,13-14,16H2,1-2,4H3,(H,30,31)/b12-6-,20-7-,27-22- |
| InChIKey | PQDHQTIGMPPZQH-VLMSNMGPSA-N |
| XLogP | 5.19 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|