About 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane
2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane (PubChem CID 169205353) has the molecular formula C19H30F3N3O
and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane.
Molecular Properties
| Compound Name | 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane |
| PubChem CID | 169205353 |
| Molecular Formula | C19H30F3N3O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane |
| SMILES | C=C(Nc1ccc(C(F)(F)F)cc1)/C(=N/C=C\C)OCCN.CC.CC |
| InChI | InChI=1S/C15H18F3N3O.2C2H6/c1-3-9-20-14(22-10-8-19)11(2)21-13-6-4-12(5-7-13)15(16,17)18;2*1-2/h3-7,9,21H,2,8,10,19H2,1H3;2*1-2H3/b9-3-,20-14-;; |
| InChIKey | KRQAZBYLDYRAGI-VNHXRJDCSA-N |
| XLogP | 5.59 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane?
The IUPAC name of 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane (CID 169205353) is 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane.
What is the SMILES notation for 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane?
The canonical SMILES for 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane is C=C(Nc1ccc(C(F)(F)F)cc1)/C(=N/C=C\C)OCCN.CC.CC.
What is the InChIKey of 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane?
The InChIKey is KRQAZBYLDYRAGI-VNHXRJDCSA-N. The full InChI is InChI=1S/C15H18F3N3O.2C2H6/c1-3-9-20-14(22-10-8-19)11(2)21-13-6-4-12(5-7-13)15(16,17)18;2*1-2/h3-7,9,21H,2,8,10,19H2,1H3;2*1-2H3/b9-3-,20-14-;;.
What are the key properties of 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane?
2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane has a molecular weight of 373.46 g/mol, XLogP of 5.59, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]prop-2-enimidate;ethane is sourced from PubChem (CID 169205353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).