C23H37F2N3 — CID 169205430
(E)-N-[(1E,3E)-1-(3,3-difluorobutan-2-ylideneamino)hepta-1,3-dien-2-yl]-2-[(Z)-prop-1-enyl]imino-3-propylhex-3-en-1-amine (PubChem CID 169205430) has the molecular formula C23H37F2N3 and a molecular weight of 393.57 g/mol. Its IUPAC name is (E)-N-[(1E,3E)-1-(3,3-difluorobutan-2-ylideneamino)hepta-1,3-dien-2-yl]-2-[(Z)-prop-1-enyl]imino-3-propylhex-3-en-1-amine.
| Compound Name | (E)-N-[(1E,3E)-1-(3,3-difluorobutan-2-ylideneamino)hepta-1,3-dien-2-yl]-2-[(Z)-prop-1-enyl]imino-3-propylhex-3-en-1-amine |
|---|---|
| PubChem CID | 169205430 |
| Molecular Formula | C23H37F2N3 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | (E)-N-[(1E,3E)-1-(3,3-difluorobutan-2-ylideneamino)hepta-1,3-dien-2-yl]-2-[(Z)-prop-1-enyl]imino-3-propylhex-3-en-1-amine |
| SMILES | C/C=C\N=C(CNC(/C=C/CCC)=C/N=C(\C)C(C)(F)F)\C(=C\CC)CCC |
| InChI | InChI=1S/C23H37F2N3/c1-7-11-12-15-21(17-27-19(5)23(6,24)25)28-18-22(26-16-10-4)20(13-8-2)14-9-3/h10,12-13,15-17,28H,7-9,11,14,18H2,1-6H3/b15-12+,16-10-,20-13+,21-17+,26-22+,27-19+ |
| InChIKey | SXXSIXITBBBJTH-FMQNCUDESA-N |
| XLogP | 7.00 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|