About 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide
3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide (PubChem CID 169205487) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide |
| PubChem CID | 169205487 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide |
| SMILES | CCNNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H13N3O3/c1-2-10-11-7(13)5-6-12-8(14)3-4-9(12)15/h3-4,10H,2,5-6H2,1H3,(H,11,13) |
| InChIKey | URJPUAKCMGBTSW-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide (CID 169205487) is 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide is CCNNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide?
The InChIKey is URJPUAKCMGBTSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3/c1-2-10-11-7(13)5-6-12-8(14)3-4-9(12)15/h3-4,10H,2,5-6H2,1H3,(H,11,13).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide?
3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide has a molecular weight of 211.22 g/mol, XLogP of -1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)-N'-ethylpropanehydrazide is sourced from PubChem (CID 169205487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).