About CID 169205966
CID 169205966 (PubChem CID 169205966) has the molecular formula C21H22BBrClN5O2
and a molecular weight of 502.61 g/mol.
Molecular Properties
| Compound Name | CID 169205966 |
| PubChem CID | 169205966 |
| Molecular Formula | C21H22BBrClN5O2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)Nc1cc(-c2c[nH]c(C(=O)N[C@H](CO)c3cnc(Br)c(C)c3)c2)c(Cl)cn1 |
| InChI | InChI=1S/C21H22BBrClN5O2/c1-11-4-13(8-27-19(11)23)17(10-30)28-20(31)16-5-12(7-25-16)14-6-18(26-9-15(14)24)29-21(2,3)22/h4-9,17,25,30H,10H2,1-3H3,(H,26,29)(H,28,31)/t17-/m1/s1 |
| InChIKey | GWIANZNXBTXBNO-QGZVFWFLSA-N |
| XLogP | 3.98 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169205966 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169205966?
The IUPAC name of CID 169205966 (CID 169205966) is not available.
What is the SMILES notation for CID 169205966?
The canonical SMILES for CID 169205966 is [B]C(C)(C)Nc1cc(-c2c[nH]c(C(=O)N[C@H](CO)c3cnc(Br)c(C)c3)c2)c(Cl)cn1.
What is the InChIKey of CID 169205966?
The InChIKey is GWIANZNXBTXBNO-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H22BBrClN5O2/c1-11-4-13(8-27-19(11)23)17(10-30)28-20(31)16-5-12(7-25-16)14-6-18(26-9-15(14)24)29-21(2,3)22/h4-9,17,25,30H,10H2,1-3H3,(H,26,29)(H,28,31)/t17-/m1/s1.
What are the key properties of CID 169205966?
CID 169205966 has a molecular weight of 502.61 g/mol, XLogP of 3.98, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169205966 is sourced from PubChem (CID 169205966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).