About CID 169206002
CID 169206002 (PubChem CID 169206002) has the molecular formula C21H18B5BrClN5O4
and a molecular weight of 573.82 g/mol.
Molecular Properties
| Compound Name | CID 169206002 |
| PubChem CID | 169206002 |
| Molecular Formula | C21H18B5BrClN5O4 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C([B])(Nc1cc(-c2c[nH]c(C(=O)NC(CO)c3cnc(Br)c(C)c3)c2)c(Cl)cn1)C([B])([B])O |
| InChI | InChI=1S/C21H18B5BrClN5O4/c1-9-2-11(6-31-17(9)27)15(8-34)32-18(35)14-3-10(5-29-14)12-4-16(30-7-13(12)28)33-19(22,20(23,24)36)21(25,26)37/h2-7,15,29,34,36-37H,8H2,1H3,(H,30,33)(H,32,35) |
| InChIKey | IEKIKGJXMLDCNF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169206002 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169206002?
The IUPAC name of CID 169206002 (CID 169206002) is not available.
What is the SMILES notation for CID 169206002?
The canonical SMILES for CID 169206002 is [B]C([B])(O)C([B])(Nc1cc(-c2c[nH]c(C(=O)NC(CO)c3cnc(Br)c(C)c3)c2)c(Cl)cn1)C([B])([B])O.
What is the InChIKey of CID 169206002?
The InChIKey is IEKIKGJXMLDCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18B5BrClN5O4/c1-9-2-11(6-31-17(9)27)15(8-34)32-18(35)14-3-10(5-29-14)12-4-16(30-7-13(12)28)33-19(22,20(23,24)36)21(25,26)37/h2-7,15,29,34,36-37H,8H2,1H3,(H,30,33)(H,32,35).
What are the key properties of CID 169206002?
CID 169206002 has a molecular weight of 573.82 g/mol, XLogP of -0.10, 9 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169206002 is sourced from PubChem (CID 169206002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).