About 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde
5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde (PubChem CID 169206219) has the molecular formula C7H4ClN3O
and a molecular weight of 181.58 g/mol. Its IUPAC name is 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde |
| PubChem CID | 169206219 |
| Molecular Formula | C7H4ClN3O |
| Molecular Weight | 181.58 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde |
| SMILES | O=Cc1cc(Cl)n2cnnc2c1 |
| InChI | InChI=1S/C7H4ClN3O/c8-6-1-5(3-12)2-7-10-9-4-11(6)7/h1-4H |
| InChIKey | XUEWUBJPFAAFDR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
The IUPAC name of 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde (CID 169206219) is 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde.
What is the SMILES notation for 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
The canonical SMILES for 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde is O=Cc1cc(Cl)n2cnnc2c1.
What is the InChIKey of 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
The InChIKey is XUEWUBJPFAAFDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O/c8-6-1-5(3-12)2-7-10-9-4-11(6)7/h1-4H.
What are the key properties of 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde has a molecular weight of 181.58 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde is sourced from PubChem (CID 169206219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).