C21H18FN5O2S — CID 169206942
4-[[5-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl)-2-pyridinyl]oxymethyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole (PubChem CID 169206942) has the molecular formula C21H18FN5O2S and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-[[5-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl)-2-pyridinyl]oxymethyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole.
| Compound Name | 4-[[5-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl)-2-pyridinyl]oxymethyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 169206942 |
| Molecular Formula | C21H18FN5O2S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-[[5-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl)-2-pyridinyl]oxymethyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole |
| SMILES | Cc1onc(-c2ccc(F)cc2)c1COc1ccc(-c2nnc3n2CCSC3)cn1 |
| InChI | InChI=1S/C21H18FN5O2S/c1-13-17(20(26-29-13)14-2-5-16(22)6-3-14)11-28-19-7-4-15(10-23-19)21-25-24-18-12-30-9-8-27(18)21/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | ZNZWUKQTDZJTCY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |