C18H16IN3O4 — CID 169207047
methyl 4-amino-1-[6-(1-hydroxyethyl)-3-pyridinyl]-7-iodo-2-oxoquinoline-3-carboxylate (PubChem CID 169207047) has the molecular formula C18H16IN3O4 and a molecular weight of 465.25 g/mol. Its IUPAC name is methyl 4-amino-1-[6-(1-hydroxyethyl)-3-pyridinyl]-7-iodo-2-oxoquinoline-3-carboxylate.
| Compound Name | methyl 4-amino-1-[6-(1-hydroxyethyl)-3-pyridinyl]-7-iodo-2-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 169207047 |
| Molecular Formula | C18H16IN3O4 |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | methyl 4-amino-1-[6-(1-hydroxyethyl)-3-pyridinyl]-7-iodo-2-oxoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(N)c2ccc(I)cc2n(-c2ccc(C(C)O)nc2)c1=O |
| InChI | InChI=1S/C18H16IN3O4/c1-9(23)13-6-4-11(8-21-13)22-14-7-10(19)3-5-12(14)16(20)15(17(22)24)18(25)26-2/h3-9,23H,20H2,1-2H3 |
| InChIKey | OKIGIFVFGOJNCH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|