C40H26F4N2O3 — CID 169207722
10'-[3,3-dimethyl-5-(3-methyl-4-pyridinyl)-2H-indol-1-yl]-4,5,6,7-tetrafluorospiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one (PubChem CID 169207722) has the molecular formula C40H26F4N2O3 and a molecular weight of 658.65 g/mol. Its IUPAC name is 10'-[3,3-dimethyl-5-(3-methyl-4-pyridinyl)-2H-indol-1-yl]-4,5,6,7-tetrafluorospiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one.
| Compound Name | 10'-[3,3-dimethyl-5-(3-methyl-4-pyridinyl)-2H-indol-1-yl]-4,5,6,7-tetrafluorospiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one |
|---|---|
| PubChem CID | 169207722 |
| Molecular Formula | C40H26F4N2O3 |
| Molecular Weight | 658.65 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | 10'-[3,3-dimethyl-5-(3-methyl-4-pyridinyl)-2H-indol-1-yl]-4,5,6,7-tetrafluorospiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one |
| SMILES | Cc1cnccc1-c1ccc2c(c1)C(C)(C)CN2c1ccc2c(c1)Oc1c(ccc3ccccc13)C21OC(=O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C40H26F4N2O3/c1-20-18-45-15-14-24(20)22-9-13-29-28(16-22)39(2,3)19-46(29)23-10-12-26-30(17-23)48-37-25-7-5-4-6-21(25)8-11-27(37)40(26)32-31(38(47)49-40)33(41)35(43)36(44)34(32)42/h4-18H,19H2,1-3H3 |
| InChIKey | LEOLUEAMXZWROL-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.65 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|