About N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine
N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine (PubChem CID 169207826) has the molecular formula C20H20F4N4O2
and a molecular weight of 424.40 g/mol. Its IUPAC name is N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine.
Molecular Properties
| Compound Name | N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine |
| PubChem CID | 169207826 |
| Molecular Formula | C20H20F4N4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine |
| SMILES | C1CCNCC1.O=CNc1n[nH]c2ccc(-c3cc(OC(F)(F)F)ccc3F)cc12 |
| InChI | InChI=1S/C15H9F4N3O2.C5H11N/c16-12-3-2-9(24-15(17,18)19)6-10(12)8-1-4-13-11(5-8)14(20-7-23)22-21-13;1-2-4-6-5-3-1/h1-7H,(H2,20,21,22,23);6H,1-5H2 |
| InChIKey | BTOJRMRSHPEHDD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine?
The IUPAC name of N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine (CID 169207826) is N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine.
What is the SMILES notation for N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine?
The canonical SMILES for N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine is C1CCNCC1.O=CNc1n[nH]c2ccc(-c3cc(OC(F)(F)F)ccc3F)cc12.
What is the InChIKey of N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine?
The InChIKey is BTOJRMRSHPEHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F4N3O2.C5H11N/c16-12-3-2-9(24-15(17,18)19)6-10(12)8-1-4-13-11(5-8)14(20-7-23)22-21-13;1-2-4-6-5-3-1/h1-7H,(H2,20,21,22,23);6H,1-5H2.
What are the key properties of N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine?
N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine has a molecular weight of 424.40 g/mol, XLogP of 4.60, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]-1H-indazol-3-yl]formamide;piperidine is sourced from PubChem (CID 169207826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).