About 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol
1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol (PubChem CID 169208694) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol.
Molecular Properties
| Compound Name | 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol |
| PubChem CID | 169208694 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol |
| SMILES | OOCC(O)C1OCc2ccccc2CO1 |
| InChI | InChI=1S/C11H14O5/c12-10(7-16-13)11-14-5-8-3-1-2-4-9(8)6-15-11/h1-4,10-13H,5-7H2 |
| InChIKey | HIGOWOVRKLAJMP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol?
The IUPAC name of 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol (CID 169208694) is 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol.
What is the SMILES notation for 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol?
The canonical SMILES for 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol is OOCC(O)C1OCc2ccccc2CO1.
What is the InChIKey of 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol?
The InChIKey is HIGOWOVRKLAJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c12-10(7-16-13)11-14-5-8-3-1-2-4-9(8)6-15-11/h1-4,10-13H,5-7H2.
What are the key properties of 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol?
1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol has a molecular weight of 226.23 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,5-dihydro-2,4-benzodioxepin-3-yl)-2-hydroperoxyethanol is sourced from PubChem (CID 169208694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).