C24H39N3O — CID 169208822
1-[9-(dimethylamino)-4b-ethyl-3-methoxy-6,7,8,8a,9,10-hexahydro-5H-phenanthren-2-yl]-N,N-dimethylazetidin-3-amine (PubChem CID 169208822) has the molecular formula C24H39N3O and a molecular weight of 385.60 g/mol. Its IUPAC name is 1-[9-(dimethylamino)-4b-ethyl-3-methoxy-6,7,8,8a,9,10-hexahydro-5H-phenanthren-2-yl]-N,N-dimethylazetidin-3-amine.
| Compound Name | 1-[9-(dimethylamino)-4b-ethyl-3-methoxy-6,7,8,8a,9,10-hexahydro-5H-phenanthren-2-yl]-N,N-dimethylazetidin-3-amine |
|---|---|
| PubChem CID | 169208822 |
| Molecular Formula | C24H39N3O |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | 1-[9-(dimethylamino)-4b-ethyl-3-methoxy-6,7,8,8a,9,10-hexahydro-5H-phenanthren-2-yl]-N,N-dimethylazetidin-3-amine |
| SMILES | CCC12CCCCC1C(N(C)C)Cc1cc(N3CC(N(C)C)C3)c(OC)cc12 |
| InChI | InChI=1S/C24H39N3O/c1-7-24-11-9-8-10-19(24)21(26(4)5)12-17-13-22(23(28-6)14-20(17)24)27-15-18(16-27)25(2)3/h13-14,18-19,21H,7-12,15-16H2,1-6H3 |
| InChIKey | BUJWITVCICKQGE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |