C29H35F2N7O — CID 169209146
1,2-difluorobenzene;ethene;N-ethyl-N-[1-[3-[2-[1-ethyl-4-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]ethynyl]-4-methylanilino]ethyl]hydroxylamine (PubChem CID 169209146) has the molecular formula C29H35F2N7O and a molecular weight of 535.64 g/mol. Its IUPAC name is 1,2-difluorobenzene;ethene;N-ethyl-N-[1-[3-[2-[1-ethyl-4-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]ethynyl]-4-methylanilino]ethyl]hydroxylamine.
| Compound Name | 1,2-difluorobenzene;ethene;N-ethyl-N-[1-[3-[2-[1-ethyl-4-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]ethynyl]-4-methylanilino]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 169209146 |
| Molecular Formula | C29H35F2N7O |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 1,2-difluorobenzene;ethene;N-ethyl-N-[1-[3-[2-[1-ethyl-4-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]ethynyl]-4-methylanilino]ethyl]hydroxylamine |
| SMILES | C=C.CCN(O)C(C)Nc1ccc(C)c(C#Cc2nn(CC)c3ncnc(NC)c23)c1.Fc1ccccc1F |
| InChI | InChI=1S/C21H27N7O.C6H4F2.C2H4/c1-6-27-21-19(20(22-5)23-13-24-21)18(26-27)11-9-16-12-17(10-8-14(16)3)25-15(4)28(29)7-2;7-5-3-1-2-4-6(5)8;1-2/h8,10,12-13,15,25,29H,6-7H2,1-5H3,(H,22,23,24);1-4H;1-2H2 |
| InChIKey | LVLJWFYOOYUHFA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|