C17H34N2O3 — CID 169209876
1,3-bis(3-butoxypropyl)imidazol-1-ium hydroxide (PubChem CID 169209876) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1,3-bis(3-butoxypropyl)imidazol-1-ium hydroxide.
| Compound Name | 1,3-bis(3-butoxypropyl)imidazol-1-ium hydroxide |
|---|---|
| PubChem CID | 169209876 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 1,3-bis(3-butoxypropyl)imidazol-1-ium hydroxide |
| SMILES | CCCCOCCCn1cc[n+](CCCOCCCC)c1.[OH-] |
| InChI | InChI=1S/C17H33N2O2.H2O/c1-3-5-13-20-15-7-9-18-11-12-19(17-18)10-8-16-21-14-6-4-2;/h11-12,17H,3-10,13-16H2,1-2H3;1H2/q+1;/p-1 |
| InChIKey | UKDZWLFOJFHFQV-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 57.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|