C21H42N8O3Si — CID 169209960
5-[8-(3-amino-1H-1,2,4-triazol-5-yl)-11-triethoxysilylundecyl]-1H-1,2,4-triazol-3-amine (PubChem CID 169209960) has the molecular formula C21H42N8O3Si and a molecular weight of 482.71 g/mol. Its IUPAC name is 5-[8-(3-amino-1H-1,2,4-triazol-5-yl)-11-triethoxysilylundecyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[8-(3-amino-1H-1,2,4-triazol-5-yl)-11-triethoxysilylundecyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 169209960 |
| Molecular Formula | C21H42N8O3Si |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 5-[8-(3-amino-1H-1,2,4-triazol-5-yl)-11-triethoxysilylundecyl]-1H-1,2,4-triazol-3-amine |
| SMILES | CCO[Si](CCCC(CCCCCCCc1nc(N)n[nH]1)c1nc(N)n[nH]1)(OCC)OCC |
| InChI | InChI=1S/C21H42N8O3Si/c1-4-30-33(31-5-2,32-6-3)16-12-14-17(19-25-21(23)29-27-19)13-10-8-7-9-11-15-18-24-20(22)28-26-18/h17H,4-16H2,1-3H3,(H3,22,24,26,28)(H3,23,25,27,29) |
| InChIKey | RBBDTINBHJUKLS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 162.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|