C23H18F3NO3 — CID 169210223
2-amino-7-[2-(2,3,5-trifluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 169210223) has the molecular formula C23H18F3NO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is 2-amino-7-[2-(2,3,5-trifluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | 2-amino-7-[2-(2,3,5-trifluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 169210223 |
| Molecular Formula | C23H18F3NO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-amino-7-[2-(2,3,5-trifluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
| SMILES | NC1(C(=O)O)CCc2ccc(Oc3ccccc3-c3cc(F)cc(F)c3F)cc2C1 |
| InChI | InChI=1S/C23H18F3NO3/c24-15-10-18(21(26)19(25)11-15)17-3-1-2-4-20(17)30-16-6-5-13-7-8-23(27,22(28)29)12-14(13)9-16/h1-6,9-11H,7-8,12,27H2,(H,28,29) |
| InChIKey | WCQGSBNEBRSMNT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|