About 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine
4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine (PubChem CID 169210854) has the molecular formula C19H23N3O2S
and a molecular weight of 357.48 g/mol. Its IUPAC name is 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine |
| PubChem CID | 169210854 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine |
| SMILES | Nc1ccc(Sc2ccc(N3CCC4(CC3)OCCO4)cc2)cc1N |
| InChI | InChI=1S/C19H23N3O2S/c20-17-6-5-16(13-18(17)21)25-15-3-1-14(2-4-15)22-9-7-19(8-10-22)23-11-12-24-19/h1-6,13H,7-12,20-21H2 |
| InChIKey | CQDBWEZATKIXLI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine?
The IUPAC name of 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine (CID 169210854) is 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine.
What is the SMILES notation for 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine?
The canonical SMILES for 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine is Nc1ccc(Sc2ccc(N3CCC4(CC3)OCCO4)cc2)cc1N.
What is the InChIKey of 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine?
The InChIKey is CQDBWEZATKIXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2S/c20-17-6-5-16(13-18(17)21)25-15-3-1-14(2-4-15)22-9-7-19(8-10-22)23-11-12-24-19/h1-6,13H,7-12,20-21H2.
What are the key properties of 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine?
4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine has a molecular weight of 357.48 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]sulfanylbenzene-1,2-diamine is sourced from PubChem (CID 169210854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).