C19H26N4O2S2 — CID 169210924
4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine (PubChem CID 169210924) has the molecular formula C19H26N4O2S2 and a molecular weight of 406.58 g/mol. Its IUPAC name is 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine.
| Compound Name | 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 169210924 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine |
| SMILES | CC1CN(c2ccc(Sc3ccc(N)c(N)c3)cc2)CC(C)N1S(C)(=O)=O |
| InChI | InChI=1S/C19H26N4O2S2/c1-13-11-22(12-14(2)23(13)27(3,24)25)15-4-6-16(7-5-15)26-17-8-9-18(20)19(21)10-17/h4-10,13-14H,11-12,20-21H2,1-3H3 |
| InChIKey | RDKSZTGVSQVUOK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|