About 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine
4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine (PubChem CID 169210924) has the molecular formula C19H26N4O2S2
and a molecular weight of 406.58 g/mol. Its IUPAC name is 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine |
| PubChem CID | 169210924 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine |
| SMILES | CC1CN(c2ccc(Sc3ccc(N)c(N)c3)cc2)CC(C)N1S(C)(=O)=O |
| InChI | InChI=1S/C19H26N4O2S2/c1-13-11-22(12-14(2)23(13)27(3,24)25)15-4-6-16(7-5-15)26-17-8-9-18(20)19(21)10-17/h4-10,13-14H,11-12,20-21H2,1-3H3 |
| InChIKey | RDKSZTGVSQVUOK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine?
The IUPAC name of 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine (CID 169210924) is 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine.
What is the SMILES notation for 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine?
The canonical SMILES for 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine is CC1CN(c2ccc(Sc3ccc(N)c(N)c3)cc2)CC(C)N1S(C)(=O)=O.
What is the InChIKey of 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine?
The InChIKey is RDKSZTGVSQVUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O2S2/c1-13-11-22(12-14(2)23(13)27(3,24)25)15-4-6-16(7-5-15)26-17-8-9-18(20)19(21)10-17/h4-10,13-14H,11-12,20-21H2,1-3H3.
What are the key properties of 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine?
4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine has a molecular weight of 406.58 g/mol, XLogP of 2.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)phenyl]sulfanylbenzene-1,2-diamine is sourced from PubChem (CID 169210924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).