C21H32N4O4S — CID 169211052
1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;4-hydroxy-N-methyl-N-[2-[methyl(pentanoyl)amino]ethyl]benzamide (PubChem CID 169211052) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;4-hydroxy-N-methyl-N-[2-[methyl(pentanoyl)amino]ethyl]benzamide.
| Compound Name | 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;4-hydroxy-N-methyl-N-[2-[methyl(pentanoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 169211052 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;4-hydroxy-N-methyl-N-[2-[methyl(pentanoyl)amino]ethyl]benzamide |
| SMILES | CCCCC(=O)N(C)CCN(C)C(=O)c1ccc(O)cc1.O=C1NC2CSCC2N1 |
| InChI | InChI=1S/C16H24N2O3.C5H8N2OS/c1-4-5-6-15(20)17(2)11-12-18(3)16(21)13-7-9-14(19)10-8-13;8-5-6-3-1-9-2-4(3)7-5/h7-10,19H,4-6,11-12H2,1-3H3;3-4H,1-2H2,(H2,6,7,8) |
| InChIKey | ZJOCONOLRJVETN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|